C9H12N8O — CID 114388978
N-(5,6-diethyl-1,2,4-triazin-3-yl)-2H-tetrazole-5-carboxamide (PubChem CID 114388978) has the molecular formula C9H12N8O and a molecular weight of 248.25 g/mol. Its IUPAC name is N-(5,6-diethyl-1,2,4-triazin-3-yl)-2H-tetrazole-5-carboxamide.
| Compound Name | N-(5,6-diethyl-1,2,4-triazin-3-yl)-2H-tetrazole-5-carboxamide |
|---|---|
| PubChem CID | 114388978 |
| Molecular Formula | C9H12N8O |
| Molecular Weight | 248.25 g/mol |
| Exact Mass | 248.11 |
| IUPAC Name | N-(5,6-diethyl-1,2,4-triazin-3-yl)-2H-tetrazole-5-carboxamide |
| SMILES | CCc1nnc(NC(=O)c2nn[nH]n2)nc1CC |
| InChI | InChI=1S/C9H12N8O/c1-3-5-6(4-2)12-15-9(10-5)11-8(18)7-13-16-17-14-7/h3-4H2,1-2H3,(H,10,11,15,18)(H,13,14,16,17) |
| InChIKey | AWXQUAHBAAAXIK-UHFFFAOYSA-N |
| XLogP | -0.24 |
| TPSA | 122.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.25 |
| LogP ≤ 5 | -0.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |