About 5-bromo-2-methyl-N-(1,2,4-triazin-3-yl)thiophene-3-sulfonamide
5-bromo-2-methyl-N-(1,2,4-triazin-3-yl)thiophene-3-sulfonamide (PubChem CID 114389141) has the molecular formula C8H7BrN4O2S2
and a molecular weight of 335.21 g/mol. Its IUPAC name is 5-bromo-2-methyl-N-(1,2,4-triazin-3-yl)thiophene-3-sulfonamide.
Molecular Properties
| Compound Name | 5-bromo-2-methyl-N-(1,2,4-triazin-3-yl)thiophene-3-sulfonamide |
| PubChem CID | 114389141 |
| Molecular Formula | C8H7BrN4O2S2 |
| Molecular Weight | 335.21 g/mol |
| Exact Mass | 333.92 |
| IUPAC Name | 5-bromo-2-methyl-N-(1,2,4-triazin-3-yl)thiophene-3-sulfonamide |
| SMILES | Cc1sc(Br)cc1S(=O)(=O)Nc1nccnn1 |
| InChI | InChI=1S/C8H7BrN4O2S2/c1-5-6(4-7(9)16-5)17(14,15)13-8-10-2-3-11-12-8/h2-4H,1H3,(H,10,12,13) |
| InChIKey | KBQVYDJEHYEFGF-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 84.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 335.21 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 5-bromo-2-methyl-N-(1,2,4-triazin-3-yl)thiophene-3-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-bromo-2-methyl-N-(1,2,4-triazin-3-yl)thiophene-3-sulfonamide?
The IUPAC name of 5-bromo-2-methyl-N-(1,2,4-triazin-3-yl)thiophene-3-sulfonamide (CID 114389141) is 5-bromo-2-methyl-N-(1,2,4-triazin-3-yl)thiophene-3-sulfonamide.
What is the SMILES notation for 5-bromo-2-methyl-N-(1,2,4-triazin-3-yl)thiophene-3-sulfonamide?
The canonical SMILES for 5-bromo-2-methyl-N-(1,2,4-triazin-3-yl)thiophene-3-sulfonamide is Cc1sc(Br)cc1S(=O)(=O)Nc1nccnn1.
What is the InChIKey of 5-bromo-2-methyl-N-(1,2,4-triazin-3-yl)thiophene-3-sulfonamide?
The InChIKey is KBQVYDJEHYEFGF-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H7BrN4O2S2/c1-5-6(4-7(9)16-5)17(14,15)13-8-10-2-3-11-12-8/h2-4H,1H3,(H,10,12,13).
What are the key properties of 5-bromo-2-methyl-N-(1,2,4-triazin-3-yl)thiophene-3-sulfonamide?
5-bromo-2-methyl-N-(1,2,4-triazin-3-yl)thiophene-3-sulfonamide has a molecular weight of 335.21 g/mol, XLogP of 1.80, 3 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 5-bromo-2-methyl-N-(1,2,4-triazin-3-yl)thiophene-3-sulfonamide is sourced from PubChem (CID 114389141), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).