About 3-bromo-N-(1,2,4-triazin-3-yl)thiophene-2-sulfonamide
3-bromo-N-(1,2,4-triazin-3-yl)thiophene-2-sulfonamide (PubChem CID 114389149) has the molecular formula C7H5BrN4O2S2
and a molecular weight of 321.18 g/mol. Its IUPAC name is 3-bromo-N-(1,2,4-triazin-3-yl)thiophene-2-sulfonamide.
Molecular Properties
| Compound Name | 3-bromo-N-(1,2,4-triazin-3-yl)thiophene-2-sulfonamide |
| PubChem CID | 114389149 |
| Molecular Formula | C7H5BrN4O2S2 |
| Molecular Weight | 321.18 g/mol |
| Exact Mass | 319.90 |
| IUPAC Name | 3-bromo-N-(1,2,4-triazin-3-yl)thiophene-2-sulfonamide |
| SMILES | O=S(=O)(Nc1nccnn1)c1sccc1Br |
| InChI | InChI=1S/C7H5BrN4O2S2/c8-5-1-4-15-6(5)16(13,14)12-7-9-2-3-10-11-7/h1-4H,(H,9,11,12) |
| InChIKey | WPZJCTUEMMTPRB-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 84.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 321.18 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 3-bromo-N-(1,2,4-triazin-3-yl)thiophene-2-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-bromo-N-(1,2,4-triazin-3-yl)thiophene-2-sulfonamide?
The IUPAC name of 3-bromo-N-(1,2,4-triazin-3-yl)thiophene-2-sulfonamide (CID 114389149) is 3-bromo-N-(1,2,4-triazin-3-yl)thiophene-2-sulfonamide.
What is the SMILES notation for 3-bromo-N-(1,2,4-triazin-3-yl)thiophene-2-sulfonamide?
The canonical SMILES for 3-bromo-N-(1,2,4-triazin-3-yl)thiophene-2-sulfonamide is O=S(=O)(Nc1nccnn1)c1sccc1Br.
What is the InChIKey of 3-bromo-N-(1,2,4-triazin-3-yl)thiophene-2-sulfonamide?
The InChIKey is WPZJCTUEMMTPRB-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H5BrN4O2S2/c8-5-1-4-15-6(5)16(13,14)12-7-9-2-3-10-11-7/h1-4H,(H,9,11,12).
What are the key properties of 3-bromo-N-(1,2,4-triazin-3-yl)thiophene-2-sulfonamide?
3-bromo-N-(1,2,4-triazin-3-yl)thiophene-2-sulfonamide has a molecular weight of 321.18 g/mol, XLogP of 1.50, 3 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 3-bromo-N-(1,2,4-triazin-3-yl)thiophene-2-sulfonamide is sourced from PubChem (CID 114389149), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).