C16H15NO — CID 114389774
N-but-3-yn-2-yl-2-naphthalen-2-ylacetamide (PubChem CID 114389774) has the molecular formula C16H15NO and a molecular weight of 237.30 g/mol. Its IUPAC name is N-but-3-yn-2-yl-2-naphthalen-2-ylacetamide.
| Compound Name | N-but-3-yn-2-yl-2-naphthalen-2-ylacetamide |
|---|---|
| PubChem CID | 114389774 |
| Molecular Formula | C16H15NO |
| Molecular Weight | 237.30 g/mol |
| Exact Mass | 237.12 |
| IUPAC Name | N-but-3-yn-2-yl-2-naphthalen-2-ylacetamide |
| SMILES | C#CC(C)NC(=O)Cc1ccc2ccccc2c1 |
| InChI | InChI=1S/C16H15NO/c1-3-12(2)17-16(18)11-13-8-9-14-6-4-5-7-15(14)10-13/h1,4-10,12H,11H2,2H3,(H,17,18) |
| InChIKey | VRDWOFHDJOEACB-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.30 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|