C13H13NO3 — CID 114390057
N-but-3-yn-2-yl-2,3-dihydro-1,4-benzodioxine-3-carboxamide (PubChem CID 114390057) has the molecular formula C13H13NO3 and a molecular weight of 231.25 g/mol. Its IUPAC name is N-but-3-yn-2-yl-2,3-dihydro-1,4-benzodioxine-3-carboxamide.
| Compound Name | N-but-3-yn-2-yl-2,3-dihydro-1,4-benzodioxine-3-carboxamide |
|---|---|
| PubChem CID | 114390057 |
| Molecular Formula | C13H13NO3 |
| Molecular Weight | 231.25 g/mol |
| Exact Mass | 231.09 |
| IUPAC Name | N-but-3-yn-2-yl-2,3-dihydro-1,4-benzodioxine-3-carboxamide |
| SMILES | C#CC(C)NC(=O)C1COc2ccccc2O1 |
| InChI | InChI=1S/C13H13NO3/c1-3-9(2)14-13(15)12-8-16-10-6-4-5-7-11(10)17-12/h1,4-7,9,12H,8H2,2H3,(H,14,15) |
| InChIKey | RSSYHFUWPXSSTK-UHFFFAOYSA-N |
| XLogP | 0.96 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.25 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|