C14H14F3NO3 — CID 114390949
4-methyl-2-[(2,4,5-trifluorophenyl)carbamoyl]cyclopentane-1-carboxylic acid (PubChem CID 114390949) has the molecular formula C14H14F3NO3 and a molecular weight of 301.26 g/mol. Its IUPAC name is 4-methyl-2-[(2,4,5-trifluorophenyl)carbamoyl]cyclopentane-1-carboxylic acid.
| Compound Name | 4-methyl-2-[(2,4,5-trifluorophenyl)carbamoyl]cyclopentane-1-carboxylic acid |
|---|---|
| PubChem CID | 114390949 |
| Molecular Formula | C14H14F3NO3 |
| Molecular Weight | 301.26 g/mol |
| Exact Mass | 301.09 |
| IUPAC Name | 4-methyl-2-[(2,4,5-trifluorophenyl)carbamoyl]cyclopentane-1-carboxylic acid |
| SMILES | CC1CC(C(=O)O)C(C(=O)Nc2cc(F)c(F)cc2F)C1 |
| InChI | InChI=1S/C14H14F3NO3/c1-6-2-7(8(3-6)14(20)21)13(19)18-12-5-10(16)9(15)4-11(12)17/h4-8H,2-3H2,1H3,(H,18,19)(H,20,21) |
| InChIKey | FZPGQWFUTDYSNH-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.26 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|