C15H10N6O4 — CID 11439147
4-amino-2-(4-hydroxyphenyl)-6-nitro-[1,2,4]triazolo[4,3-a]quinoxalin-1-one (PubChem CID 11439147) has the molecular formula C15H10N6O4 and a molecular weight of 338.28 g/mol. Its IUPAC name is 4-amino-2-(4-hydroxyphenyl)-6-nitro-[1,2,4]triazolo[4,3-a]quinoxalin-1-one.
| Compound Name | 4-amino-2-(4-hydroxyphenyl)-6-nitro-[1,2,4]triazolo[4,3-a]quinoxalin-1-one |
|---|---|
| PubChem CID | 11439147 |
| Molecular Formula | C15H10N6O4 |
| Molecular Weight | 338.28 g/mol |
| Exact Mass | 338.08 |
| IUPAC Name | 4-amino-2-(4-hydroxyphenyl)-6-nitro-[1,2,4]triazolo[4,3-a]quinoxalin-1-one |
| SMILES | Nc1nc2c([N+](=O)[O-])cccc2n2c(=O)n(-c3ccc(O)cc3)nc12 |
| InChI | InChI=1S/C15H10N6O4/c16-13-14-18-20(8-4-6-9(22)7-5-8)15(23)19(14)10-2-1-3-11(21(24)25)12(10)17-13/h1-7,22H,(H2,16,17) |
| InChIKey | ZNGGCOOMIJEOKO-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 141.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.28 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|