C19H19N2O2P — CID 11439152
[(benzylamino)-pyridin-2-ylmethyl]-phenylphosphinic acid (PubChem CID 11439152) has the molecular formula C19H19N2O2P and a molecular weight of 338.35 g/mol. Its IUPAC name is [(benzylamino)-pyridin-2-ylmethyl]-phenylphosphinic acid.
| Compound Name | [(benzylamino)-pyridin-2-ylmethyl]-phenylphosphinic acid |
|---|---|
| PubChem CID | 11439152 |
| Molecular Formula | C19H19N2O2P |
| Molecular Weight | 338.35 g/mol |
| Exact Mass | 338.12 |
| IUPAC Name | [(benzylamino)-pyridin-2-ylmethyl]-phenylphosphinic acid |
| SMILES | O=P(O)(c1ccccc1)C(NCc1ccccc1)c1ccccn1 |
| InChI | InChI=1S/C19H19N2O2P/c22-24(23,17-11-5-2-6-12-17)19(18-13-7-8-14-20-18)21-15-16-9-3-1-4-10-16/h1-14,19,21H,15H2,(H,22,23) |
| InChIKey | KBFFGLYTLUYFCS-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 62.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.35 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|