C16H26N4S2 — CID 11439182
3,6-dicyclohexyl-1,3a,4,6a-tetrahydroimidazo[4,5-d]imidazole-2,5-dithione (PubChem CID 11439182) has the molecular formula C16H26N4S2 and a molecular weight of 338.55 g/mol. Its IUPAC name is 3,6-dicyclohexyl-1,3a,4,6a-tetrahydroimidazo[4,5-d]imidazole-2,5-dithione.
| Compound Name | 3,6-dicyclohexyl-1,3a,4,6a-tetrahydroimidazo[4,5-d]imidazole-2,5-dithione |
|---|---|
| PubChem CID | 11439182 |
| Molecular Formula | C16H26N4S2 |
| Molecular Weight | 338.55 g/mol |
| Exact Mass | 338.16 |
| IUPAC Name | 3,6-dicyclohexyl-1,3a,4,6a-tetrahydroimidazo[4,5-d]imidazole-2,5-dithione |
| SMILES | S=C1NC2C(NC(=S)N2C2CCCCC2)N1C1CCCCC1 |
| InChI | InChI=1S/C16H26N4S2/c21-15-18-14-13(19(15)11-7-3-1-4-8-11)17-16(22)20(14)12-9-5-2-6-10-12/h11-14H,1-10H2,(H,17,22)(H,18,21) |
| InChIKey | RRWWKLHNDUXPBY-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 30.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.55 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|