About tert-butyl (Z)-octadec-9-enoate
tert-butyl (Z)-octadec-9-enoate (PubChem CID 11439184) has the molecular formula C22H42O2
and a molecular weight of 338.58 g/mol. Its IUPAC name is tert-butyl (Z)-octadec-9-enoate.
Molecular Properties
| Compound Name | tert-butyl (Z)-octadec-9-enoate |
| PubChem CID | 11439184 |
| Molecular Formula | C22H42O2 |
| Molecular Weight | 338.58 g/mol |
| Exact Mass | 338.32 |
| IUPAC Name | tert-butyl (Z)-octadec-9-enoate |
| SMILES | CCCCCCCC/C=C\CCCCCCCC(=O)OC(C)(C)C |
| InChI | InChI=1S/C22H42O2/c1-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21(23)24-22(2,3)4/h12-13H,5-11,14-20H2,1-4H3/b13-12- |
| InChIKey | WLUJQOWLPINFQA-SEYXRHQNSA-N |
| XLogP | 7.37 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 338.58 |
| LogP ≤ 5 | 7.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze tert-butyl (Z)-octadec-9-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl (Z)-octadec-9-enoate?
The IUPAC name of tert-butyl (Z)-octadec-9-enoate (CID 11439184) is tert-butyl (Z)-octadec-9-enoate.
What is the SMILES notation for tert-butyl (Z)-octadec-9-enoate?
The canonical SMILES for tert-butyl (Z)-octadec-9-enoate is CCCCCCCC/C=C\CCCCCCCC(=O)OC(C)(C)C.
What is the InChIKey of tert-butyl (Z)-octadec-9-enoate?
The InChIKey is WLUJQOWLPINFQA-SEYXRHQNSA-N. The full InChI is InChI=1S/C22H42O2/c1-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21(23)24-22(2,3)4/h12-13H,5-11,14-20H2,1-4H3/b13-12-.
What are the key properties of tert-butyl (Z)-octadec-9-enoate?
tert-butyl (Z)-octadec-9-enoate has a molecular weight of 338.58 g/mol, XLogP of 7.37, 15 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl (Z)-octadec-9-enoate is sourced from PubChem (CID 11439184), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).