About 2-(5-chloro-7-methyl-1,3-benzoxazol-2-yl)-4-methylcyclopentane-1-carboxylic acid
2-(5-chloro-7-methyl-1,3-benzoxazol-2-yl)-4-methylcyclopentane-1-carboxylic acid (PubChem CID 114392611) has the molecular formula C15H16ClNO3
and a molecular weight of 293.75 g/mol. Its IUPAC name is 2-(5-chloro-7-methyl-1,3-benzoxazol-2-yl)-4-methylcyclopentane-1-carboxylic acid.
Molecular Properties
| Compound Name | 2-(5-chloro-7-methyl-1,3-benzoxazol-2-yl)-4-methylcyclopentane-1-carboxylic acid |
| PubChem CID | 114392611 |
| Molecular Formula | C15H16ClNO3 |
| Molecular Weight | 293.75 g/mol |
| Exact Mass | 293.08 |
| IUPAC Name | 2-(5-chloro-7-methyl-1,3-benzoxazol-2-yl)-4-methylcyclopentane-1-carboxylic acid |
| SMILES | Cc1cc(Cl)cc2nc(C3CC(C)CC3C(=O)O)oc12 |
| InChI | InChI=1S/C15H16ClNO3/c1-7-3-10(11(4-7)15(18)19)14-17-12-6-9(16)5-8(2)13(12)20-14/h5-7,10-11H,3-4H2,1-2H3,(H,18,19) |
| InChIKey | QXFQYGNABGYXLT-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 63.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 293.75 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-(5-chloro-7-methyl-1,3-benzoxazol-2-yl)-4-methylcyclopentane-1-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(5-chloro-7-methyl-1,3-benzoxazol-2-yl)-4-methylcyclopentane-1-carboxylic acid?
The IUPAC name of 2-(5-chloro-7-methyl-1,3-benzoxazol-2-yl)-4-methylcyclopentane-1-carboxylic acid (CID 114392611) is 2-(5-chloro-7-methyl-1,3-benzoxazol-2-yl)-4-methylcyclopentane-1-carboxylic acid.
What is the SMILES notation for 2-(5-chloro-7-methyl-1,3-benzoxazol-2-yl)-4-methylcyclopentane-1-carboxylic acid?
The canonical SMILES for 2-(5-chloro-7-methyl-1,3-benzoxazol-2-yl)-4-methylcyclopentane-1-carboxylic acid is Cc1cc(Cl)cc2nc(C3CC(C)CC3C(=O)O)oc12.
What is the InChIKey of 2-(5-chloro-7-methyl-1,3-benzoxazol-2-yl)-4-methylcyclopentane-1-carboxylic acid?
The InChIKey is QXFQYGNABGYXLT-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H16ClNO3/c1-7-3-10(11(4-7)15(18)19)14-17-12-6-9(16)5-8(2)13(12)20-14/h5-7,10-11H,3-4H2,1-2H3,(H,18,19).
What are the key properties of 2-(5-chloro-7-methyl-1,3-benzoxazol-2-yl)-4-methylcyclopentane-1-carboxylic acid?
2-(5-chloro-7-methyl-1,3-benzoxazol-2-yl)-4-methylcyclopentane-1-carboxylic acid has a molecular weight of 293.75 g/mol, XLogP of 4.00, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(5-chloro-7-methyl-1,3-benzoxazol-2-yl)-4-methylcyclopentane-1-carboxylic acid is sourced from PubChem (CID 114392611), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).