4-methyl-2-(1H-1,2,4-triazol-5-yl)cyclopentane-1-carboxylic acid

C9H13N3O2 — CID 114392952

IUPAC4-methyl-2-(1H-1,2,4-triazol-5-yl)cyclopentane-1-carboxylic acid
SMILESCC1CC(C(=O)O)C(c2ncn[nH]2)C1
InChIInChI=1S/C9H13N3O2/c1-5-2-6(7(3-5)9(13)14)8-10-4-11-12-8/h4-7H,2-3H2,1H3,(H,13,14)(H,10,11,12)
InChIKeyGOSUHMOZDAGILH-UHFFFAOYSA-N
MW195.22 g/mol
LogP1.02
Rot. Bonds2

About 4-methyl-2-(1H-1,2,4-triazol-5-yl)cyclopentane-1-carboxylic acid

4-methyl-2-(1H-1,2,4-triazol-5-yl)cyclopentane-1-carboxylic acid (PubChem CID 114392952) has the molecular formula C9H13N3O2 and a molecular weight of 195.22 g/mol. Its IUPAC name is 4-methyl-2-(1H-1,2,4-triazol-5-yl)cyclopentane-1-carboxylic acid.

Molecular Properties

Compound Name4-methyl-2-(1H-1,2,4-triazol-5-yl)cyclopentane-1-carboxylic acid
PubChem CID114392952
Molecular FormulaC9H13N3O2
Molecular Weight195.22 g/mol
Exact Mass195.10
IUPAC Name4-methyl-2-(1H-1,2,4-triazol-5-yl)cyclopentane-1-carboxylic acid
SMILESCC1CC(C(=O)O)C(c2ncn[nH]2)C1
InChIInChI=1S/C9H13N3O2/c1-5-2-6(7(3-5)9(13)14)8-10-4-11-12-8/h4-7H,2-3H2,1H3,(H,13,14)(H,10,11,12)
InChIKeyGOSUHMOZDAGILH-UHFFFAOYSA-N
XLogP1.02
TPSA78.87 Ų
H-Bond Donors2
H-Bond Acceptors3
Rotatable Bonds2
Heavy Atoms14
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500195.22
LogP ≤ 51.02
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 103

Analyze 4-methyl-2-(1H-1,2,4-triazol-5-yl)cyclopentane-1-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 4-methyl-2-(1H-1,2,4-triazol-5-yl)cyclopentane-1-carboxylic acid?
The IUPAC name of 4-methyl-2-(1H-1,2,4-triazol-5-yl)cyclopentane-1-carboxylic acid (CID 114392952) is 4-methyl-2-(1H-1,2,4-triazol-5-yl)cyclopentane-1-carboxylic acid.
What is the SMILES notation for 4-methyl-2-(1H-1,2,4-triazol-5-yl)cyclopentane-1-carboxylic acid?
The canonical SMILES for 4-methyl-2-(1H-1,2,4-triazol-5-yl)cyclopentane-1-carboxylic acid is CC1CC(C(=O)O)C(c2ncn[nH]2)C1.
What is the InChIKey of 4-methyl-2-(1H-1,2,4-triazol-5-yl)cyclopentane-1-carboxylic acid?
The InChIKey is GOSUHMOZDAGILH-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H13N3O2/c1-5-2-6(7(3-5)9(13)14)8-10-4-11-12-8/h4-7H,2-3H2,1H3,(H,13,14)(H,10,11,12).
What are the key properties of 4-methyl-2-(1H-1,2,4-triazol-5-yl)cyclopentane-1-carboxylic acid?
4-methyl-2-(1H-1,2,4-triazol-5-yl)cyclopentane-1-carboxylic acid has a molecular weight of 195.22 g/mol, XLogP of 1.02, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methyl-2-(1H-1,2,4-triazol-5-yl)cyclopentane-1-carboxylic acid is sourced from PubChem (CID 114392952), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).