C10H15N3O2 — CID 114393019
4-(2,6-dimethylmorpholin-4-yl)-1H-pyridazin-6-one (PubChem CID 114393019) has the molecular formula C10H15N3O2 and a molecular weight of 209.25 g/mol. Its IUPAC name is 4-(2,6-dimethylmorpholin-4-yl)-1H-pyridazin-6-one.
| Compound Name | 4-(2,6-dimethylmorpholin-4-yl)-1H-pyridazin-6-one |
|---|---|
| PubChem CID | 114393019 |
| Molecular Formula | C10H15N3O2 |
| Molecular Weight | 209.25 g/mol |
| Exact Mass | 209.12 |
| IUPAC Name | 4-(2,6-dimethylmorpholin-4-yl)-1H-pyridazin-6-one |
| SMILES | CC1CN(c2cn[nH]c(=O)c2)CC(C)O1 |
| InChI | InChI=1S/C10H15N3O2/c1-7-5-13(6-8(2)15-7)9-3-10(14)12-11-4-9/h3-4,7-8H,5-6H2,1-2H3,(H,12,14) |
| InChIKey | KLIXJIHDXMBDBP-UHFFFAOYSA-N |
| XLogP | 0.38 |
| TPSA | 58.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.25 |
| LogP ≤ 5 | 0.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |