C17H19ClN6 — CID 11439306
N-(2-chloro-6-methylphenyl)-3,5,12-trimethyl-1,3,4,7,11-pentazatricyclo[7.3.0.02,6]dodeca-4,7,9,11-tetraen-8-amine (PubChem CID 11439306) has the molecular formula C17H19ClN6 and a molecular weight of 342.83 g/mol. Its IUPAC name is N-(2-chloro-6-methylphenyl)-3,5,12-trimethyl-1,3,4,7,11-pentazatricyclo[7.3.0.02,6]dodeca-4,7,9,11-tetraen-8-amine.
| Compound Name | N-(2-chloro-6-methylphenyl)-3,5,12-trimethyl-1,3,4,7,11-pentazatricyclo[7.3.0.02,6]dodeca-4,7,9,11-tetraen-8-amine |
|---|---|
| PubChem CID | 11439306 |
| Molecular Formula | C17H19ClN6 |
| Molecular Weight | 342.83 g/mol |
| Exact Mass | 342.14 |
| IUPAC Name | N-(2-chloro-6-methylphenyl)-3,5,12-trimethyl-1,3,4,7,11-pentazatricyclo[7.3.0.02,6]dodeca-4,7,9,11-tetraen-8-amine |
| SMILES | CC1=NN(C)C2C1N=C(Nc1c(C)cccc1Cl)c1cnc(C)n12 |
| InChI | InChI=1S/C17H19ClN6/c1-9-6-5-7-12(18)14(9)20-16-13-8-19-11(3)24(13)17-15(21-16)10(2)22-23(17)4/h5-8,15,17H,1-4H3,(H,20,21) |
| InChIKey | VVCCPVFLCHZEGL-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 57.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.83 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |