C7H8F3N3O — CID 114393072
4-[methyl(2,2,2-trifluoroethyl)amino]-1H-pyridazin-6-one (PubChem CID 114393072) has the molecular formula C7H8F3N3O and a molecular weight of 207.16 g/mol. Its IUPAC name is 4-[methyl(2,2,2-trifluoroethyl)amino]-1H-pyridazin-6-one.
| Compound Name | 4-[methyl(2,2,2-trifluoroethyl)amino]-1H-pyridazin-6-one |
|---|---|
| PubChem CID | 114393072 |
| Molecular Formula | C7H8F3N3O |
| Molecular Weight | 207.16 g/mol |
| Exact Mass | 207.06 |
| IUPAC Name | 4-[methyl(2,2,2-trifluoroethyl)amino]-1H-pyridazin-6-one |
| SMILES | CN(CC(F)(F)F)c1cn[nH]c(=O)c1 |
| InChI | InChI=1S/C7H8F3N3O/c1-13(4-7(8,9)10)5-2-6(14)12-11-3-5/h2-3H,4H2,1H3,(H,12,14) |
| InChIKey | DVNDIRDIDFVYKR-UHFFFAOYSA-N |
| XLogP | 0.77 |
| TPSA | 48.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.16 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |