C10H13N5O2 — CID 114393184
7-(6-oxo-1H-pyridazin-4-yl)-1,2,5,6,8,8a-hexahydroimidazo[1,5-a]pyrazin-3-one (PubChem CID 114393184) has the molecular formula C10H13N5O2 and a molecular weight of 235.25 g/mol. Its IUPAC name is 7-(6-oxo-1H-pyridazin-4-yl)-1,2,5,6,8,8a-hexahydroimidazo[1,5-a]pyrazin-3-one.
| Compound Name | 7-(6-oxo-1H-pyridazin-4-yl)-1,2,5,6,8,8a-hexahydroimidazo[1,5-a]pyrazin-3-one |
|---|---|
| PubChem CID | 114393184 |
| Molecular Formula | C10H13N5O2 |
| Molecular Weight | 235.25 g/mol |
| Exact Mass | 235.11 |
| IUPAC Name | 7-(6-oxo-1H-pyridazin-4-yl)-1,2,5,6,8,8a-hexahydroimidazo[1,5-a]pyrazin-3-one |
| SMILES | O=C1NCC2CN(c3cn[nH]c(=O)c3)CCN12 |
| InChI | InChI=1S/C10H13N5O2/c16-9-3-7(5-12-13-9)14-1-2-15-8(6-14)4-11-10(15)17/h3,5,8H,1-2,4,6H2,(H,11,17)(H,13,16) |
| InChIKey | ZTASXSIUGXEWHV-UHFFFAOYSA-N |
| XLogP | -1.02 |
| TPSA | 81.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.25 |
| LogP ≤ 5 | -1.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |