C19H36O5 — CID 11439354
(2R)-2-[(4R,5S,6S)-2,2,5-trimethyl-6-[(1R)-1-[(4S,5S)-2,2,5-trimethyl-1,3-dioxan-4-yl]ethyl]-1,3-dioxan-4-yl]propan-1-ol (PubChem CID 11439354) has the molecular formula C19H36O5 and a molecular weight of 344.49 g/mol. Its IUPAC name is (2R)-2-[(4R,5S,6S)-2,2,5-trimethyl-6-[(1R)-1-[(4S,5S)-2,2,5-trimethyl-1,3-dioxan-4-yl]ethyl]-1,3-dioxan-4-yl]propan-1-ol.
| Compound Name | (2R)-2-[(4R,5S,6S)-2,2,5-trimethyl-6-[(1R)-1-[(4S,5S)-2,2,5-trimethyl-1,3-dioxan-4-yl]ethyl]-1,3-dioxan-4-yl]propan-1-ol |
|---|---|
| PubChem CID | 11439354 |
| Molecular Formula | C19H36O5 |
| Molecular Weight | 344.49 g/mol |
| Exact Mass | 344.26 |
| IUPAC Name | (2R)-2-[(4R,5S,6S)-2,2,5-trimethyl-6-[(1R)-1-[(4S,5S)-2,2,5-trimethyl-1,3-dioxan-4-yl]ethyl]-1,3-dioxan-4-yl]propan-1-ol |
| SMILES | C[C@@H]1[C@@H]([C@H](C)[C@H]2OC(C)(C)OC[C@@H]2C)OC(C)(C)O[C@@H]1[C@H](C)CO |
| InChI | InChI=1S/C19H36O5/c1-11(9-20)15-13(3)17(24-19(7,8)23-15)14(4)16-12(2)10-21-18(5,6)22-16/h11-17,20H,9-10H2,1-8H3/t11-,12+,13+,14-,15-,16+,17+/m1/s1 |
| InChIKey | NBWKDXDDWLVGBR-AADFWWHXSA-N |
| XLogP | 3.19 |
| TPSA | 57.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.49 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |