About 2-(3-amino-1,1,1-trifluoropropan-2-yl)-5-(4-methylpiperidin-1-yl)pyridazin-3-one
2-(3-amino-1,1,1-trifluoropropan-2-yl)-5-(4-methylpiperidin-1-yl)pyridazin-3-one (PubChem CID 114393623) has the molecular formula C13H19F3N4O
and a molecular weight of 304.32 g/mol. Its IUPAC name is 2-(3-amino-1,1,1-trifluoropropan-2-yl)-5-(4-methylpiperidin-1-yl)pyridazin-3-one.
Molecular Properties
| Compound Name | 2-(3-amino-1,1,1-trifluoropropan-2-yl)-5-(4-methylpiperidin-1-yl)pyridazin-3-one |
| PubChem CID | 114393623 |
| Molecular Formula | C13H19F3N4O |
| Molecular Weight | 304.32 g/mol |
| Exact Mass | 304.15 |
| IUPAC Name | 2-(3-amino-1,1,1-trifluoropropan-2-yl)-5-(4-methylpiperidin-1-yl)pyridazin-3-one |
| SMILES | CC1CCN(c2cnn(C(CN)C(F)(F)F)c(=O)c2)CC1 |
| InChI | InChI=1S/C13H19F3N4O/c1-9-2-4-19(5-3-9)10-6-12(21)20(18-8-10)11(7-17)13(14,15)16/h6,8-9,11H,2-5,7,17H2,1H3 |
| InChIKey | NGGWMECWBZECRB-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 64.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 304.32 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-(3-amino-1,1,1-trifluoropropan-2-yl)-5-(4-methylpiperidin-1-yl)pyridazin-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(3-amino-1,1,1-trifluoropropan-2-yl)-5-(4-methylpiperidin-1-yl)pyridazin-3-one?
The IUPAC name of 2-(3-amino-1,1,1-trifluoropropan-2-yl)-5-(4-methylpiperidin-1-yl)pyridazin-3-one (CID 114393623) is 2-(3-amino-1,1,1-trifluoropropan-2-yl)-5-(4-methylpiperidin-1-yl)pyridazin-3-one.
What is the SMILES notation for 2-(3-amino-1,1,1-trifluoropropan-2-yl)-5-(4-methylpiperidin-1-yl)pyridazin-3-one?
The canonical SMILES for 2-(3-amino-1,1,1-trifluoropropan-2-yl)-5-(4-methylpiperidin-1-yl)pyridazin-3-one is CC1CCN(c2cnn(C(CN)C(F)(F)F)c(=O)c2)CC1.
What is the InChIKey of 2-(3-amino-1,1,1-trifluoropropan-2-yl)-5-(4-methylpiperidin-1-yl)pyridazin-3-one?
The InChIKey is NGGWMECWBZECRB-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H19F3N4O/c1-9-2-4-19(5-3-9)10-6-12(21)20(18-8-10)11(7-17)13(14,15)16/h6,8-9,11H,2-5,7,17H2,1H3.
What are the key properties of 2-(3-amino-1,1,1-trifluoropropan-2-yl)-5-(4-methylpiperidin-1-yl)pyridazin-3-one?
2-(3-amino-1,1,1-trifluoropropan-2-yl)-5-(4-methylpiperidin-1-yl)pyridazin-3-one has a molecular weight of 304.32 g/mol, XLogP of 1.54, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3-amino-1,1,1-trifluoropropan-2-yl)-5-(4-methylpiperidin-1-yl)pyridazin-3-one is sourced from PubChem (CID 114393623), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).