About 2-(5-amino-4,4-dimethylpentyl)-5-morpholin-4-ylpyridazin-3-one
2-(5-amino-4,4-dimethylpentyl)-5-morpholin-4-ylpyridazin-3-one (PubChem CID 114393699) has the molecular formula C15H26N4O2
and a molecular weight of 294.40 g/mol. Its IUPAC name is 2-(5-amino-4,4-dimethylpentyl)-5-morpholin-4-ylpyridazin-3-one.
Molecular Properties
| Compound Name | 2-(5-amino-4,4-dimethylpentyl)-5-morpholin-4-ylpyridazin-3-one |
| PubChem CID | 114393699 |
| Molecular Formula | C15H26N4O2 |
| Molecular Weight | 294.40 g/mol |
| Exact Mass | 294.21 |
| IUPAC Name | 2-(5-amino-4,4-dimethylpentyl)-5-morpholin-4-ylpyridazin-3-one |
| SMILES | CC(C)(CN)CCCn1ncc(N2CCOCC2)cc1=O |
| InChI | InChI=1S/C15H26N4O2/c1-15(2,12-16)4-3-5-19-14(20)10-13(11-17-19)18-6-8-21-9-7-18/h10-11H,3-9,12,16H2,1-2H3 |
| InChIKey | YNERAPRVLPJBRK-UHFFFAOYSA-N |
| XLogP | 0.85 |
| TPSA | 73.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 294.40 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 2-(5-amino-4,4-dimethylpentyl)-5-morpholin-4-ylpyridazin-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(5-amino-4,4-dimethylpentyl)-5-morpholin-4-ylpyridazin-3-one?
The IUPAC name of 2-(5-amino-4,4-dimethylpentyl)-5-morpholin-4-ylpyridazin-3-one (CID 114393699) is 2-(5-amino-4,4-dimethylpentyl)-5-morpholin-4-ylpyridazin-3-one.
What is the SMILES notation for 2-(5-amino-4,4-dimethylpentyl)-5-morpholin-4-ylpyridazin-3-one?
The canonical SMILES for 2-(5-amino-4,4-dimethylpentyl)-5-morpholin-4-ylpyridazin-3-one is CC(C)(CN)CCCn1ncc(N2CCOCC2)cc1=O.
What is the InChIKey of 2-(5-amino-4,4-dimethylpentyl)-5-morpholin-4-ylpyridazin-3-one?
The InChIKey is YNERAPRVLPJBRK-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H26N4O2/c1-15(2,12-16)4-3-5-19-14(20)10-13(11-17-19)18-6-8-21-9-7-18/h10-11H,3-9,12,16H2,1-2H3.
What are the key properties of 2-(5-amino-4,4-dimethylpentyl)-5-morpholin-4-ylpyridazin-3-one?
2-(5-amino-4,4-dimethylpentyl)-5-morpholin-4-ylpyridazin-3-one has a molecular weight of 294.40 g/mol, XLogP of 0.85, 6 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(5-amino-4,4-dimethylpentyl)-5-morpholin-4-ylpyridazin-3-one is sourced from PubChem (CID 114393699), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).