C13H19N3O4 — CID 114393825
methyl 2-hydroxy-2-methyl-3-(6-oxo-4-pyrrolidin-1-ylpyridazin-1-yl)propanoate (PubChem CID 114393825) has the molecular formula C13H19N3O4 and a molecular weight of 281.31 g/mol. Its IUPAC name is methyl 2-hydroxy-2-methyl-3-(6-oxo-4-pyrrolidin-1-ylpyridazin-1-yl)propanoate.
| Compound Name | methyl 2-hydroxy-2-methyl-3-(6-oxo-4-pyrrolidin-1-ylpyridazin-1-yl)propanoate |
|---|---|
| PubChem CID | 114393825 |
| Molecular Formula | C13H19N3O4 |
| Molecular Weight | 281.31 g/mol |
| Exact Mass | 281.14 |
| IUPAC Name | methyl 2-hydroxy-2-methyl-3-(6-oxo-4-pyrrolidin-1-ylpyridazin-1-yl)propanoate |
| SMILES | COC(=O)C(C)(O)Cn1ncc(N2CCCC2)cc1=O |
| InChI | InChI=1S/C13H19N3O4/c1-13(19,12(18)20-2)9-16-11(17)7-10(8-14-16)15-5-3-4-6-15/h7-8,19H,3-6,9H2,1-2H3 |
| InChIKey | UNHYHCMSRNOCHC-UHFFFAOYSA-N |
| XLogP | -0.23 |
| TPSA | 84.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.31 |
| LogP ≤ 5 | -0.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |