C12H17N3O3 — CID 114394009
(Z)-4-[4-[ethyl(methyl)amino]-6-oxopyridazin-1-yl]-2-methylbut-2-enoic acid (PubChem CID 114394009) has the molecular formula C12H17N3O3 and a molecular weight of 251.29 g/mol. Its IUPAC name is (Z)-4-[4-[ethyl(methyl)amino]-6-oxopyridazin-1-yl]-2-methylbut-2-enoic acid.
| Compound Name | (Z)-4-[4-[ethyl(methyl)amino]-6-oxopyridazin-1-yl]-2-methylbut-2-enoic acid |
|---|---|
| PubChem CID | 114394009 |
| Molecular Formula | C12H17N3O3 |
| Molecular Weight | 251.29 g/mol |
| Exact Mass | 251.13 |
| IUPAC Name | (Z)-4-[4-[ethyl(methyl)amino]-6-oxopyridazin-1-yl]-2-methylbut-2-enoic acid |
| SMILES | CCN(C)c1cnn(C/C=C(/C)C(=O)O)c(=O)c1 |
| InChI | InChI=1S/C12H17N3O3/c1-4-14(3)10-7-11(16)15(13-8-10)6-5-9(2)12(17)18/h5,7-8H,4,6H2,1-3H3,(H,17,18)/b9-5- |
| InChIKey | NRTUOWFKQPUMNG-UITAMQMPSA-N |
| XLogP | 0.73 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.29 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|