C13H18FN3O4 — CID 114394178
ethyl 2-fluoro-2-[4-(3-methoxypyrrolidin-1-yl)-6-oxopyridazin-1-yl]acetate (PubChem CID 114394178) has the molecular formula C13H18FN3O4 and a molecular weight of 299.30 g/mol. Its IUPAC name is ethyl 2-fluoro-2-[4-(3-methoxypyrrolidin-1-yl)-6-oxopyridazin-1-yl]acetate.
| Compound Name | ethyl 2-fluoro-2-[4-(3-methoxypyrrolidin-1-yl)-6-oxopyridazin-1-yl]acetate |
|---|---|
| PubChem CID | 114394178 |
| Molecular Formula | C13H18FN3O4 |
| Molecular Weight | 299.30 g/mol |
| Exact Mass | 299.13 |
| IUPAC Name | ethyl 2-fluoro-2-[4-(3-methoxypyrrolidin-1-yl)-6-oxopyridazin-1-yl]acetate |
| SMILES | CCOC(=O)C(F)n1ncc(N2CCC(OC)C2)cc1=O |
| InChI | InChI=1S/C13H18FN3O4/c1-3-21-13(19)12(14)17-11(18)6-9(7-15-17)16-5-4-10(8-16)20-2/h6-7,10,12H,3-5,8H2,1-2H3 |
| InChIKey | IJTCIYOQMOTFFG-UHFFFAOYSA-N |
| XLogP | 0.50 |
| TPSA | 73.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.30 |
| LogP ≤ 5 | 0.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |