C15H12N2O2S3 — CID 11439466
N-(4,5-dihydrothieno[3,2-e][1,3]benzothiazol-2-yl)benzenesulfonamide (PubChem CID 11439466) has the molecular formula C15H12N2O2S3 and a molecular weight of 348.47 g/mol. Its IUPAC name is N-(4,5-dihydrothieno[3,2-e][1,3]benzothiazol-2-yl)benzenesulfonamide.
| Compound Name | N-(4,5-dihydrothieno[3,2-e][1,3]benzothiazol-2-yl)benzenesulfonamide |
|---|---|
| PubChem CID | 11439466 |
| Molecular Formula | C15H12N2O2S3 |
| Molecular Weight | 348.47 g/mol |
| Exact Mass | 348.01 |
| IUPAC Name | N-(4,5-dihydrothieno[3,2-e][1,3]benzothiazol-2-yl)benzenesulfonamide |
| SMILES | O=S(=O)(Nc1nc2c(s1)CCc1sccc1-2)c1ccccc1 |
| InChI | InChI=1S/C15H12N2O2S3/c18-22(19,10-4-2-1-3-5-10)17-15-16-14-11-8-9-20-12(11)6-7-13(14)21-15/h1-5,8-9H,6-7H2,(H,16,17) |
| InChIKey | BLTIIVURSXLRMW-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 59.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.47 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'sulfonamide_F(1)', 'substructure': 'N/A'} |
|---|