C16H19N3O4S — CID 11439493
[(1R,4S)-2,5-diazabicyclo[2.2.1]heptan-3-yl]-(6-ethoxy-1,2-benzothiazol-3-yl)methanone;formic acid (PubChem CID 11439493) has the molecular formula C16H19N3O4S and a molecular weight of 349.41 g/mol. Its IUPAC name is [(1R,4S)-2,5-diazabicyclo[2.2.1]heptan-3-yl]-(6-ethoxy-1,2-benzothiazol-3-yl)methanone;formic acid.
| Compound Name | [(1R,4S)-2,5-diazabicyclo[2.2.1]heptan-3-yl]-(6-ethoxy-1,2-benzothiazol-3-yl)methanone;formic acid |
|---|---|
| PubChem CID | 11439493 |
| Molecular Formula | C16H19N3O4S |
| Molecular Weight | 349.41 g/mol |
| Exact Mass | 349.11 |
| IUPAC Name | [(1R,4S)-2,5-diazabicyclo[2.2.1]heptan-3-yl]-(6-ethoxy-1,2-benzothiazol-3-yl)methanone;formic acid |
| SMILES | CCOc1ccc2c(C(=O)C3N[C@H]4CN[C@H]3C4)nsc2c1.O=CO |
| InChI | InChI=1S/C15H17N3O2S.CH2O2/c1-2-20-9-3-4-10-12(6-9)21-18-13(10)15(19)14-11-5-8(17-14)7-16-11;2-1-3/h3-4,6,8,11,14,16-17H,2,5,7H2,1H3;1H,(H,2,3)/t8-,11+,14?;/m1./s1 |
| InChIKey | JCHIQVCBKDOPRX-MRYSRCRHSA-N |
| XLogP | 1.28 |
| TPSA | 100.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.41 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|