C14H20ClN3O2 — CID 114395086
2-[2-(aminomethyl)morpholin-4-yl]-N-(4-chloro-2-methylphenyl)acetamide (PubChem CID 114395086) has the molecular formula C14H20ClN3O2 and a molecular weight of 297.79 g/mol. Its IUPAC name is 2-[2-(aminomethyl)morpholin-4-yl]-N-(4-chloro-2-methylphenyl)acetamide.
| Compound Name | 2-[2-(aminomethyl)morpholin-4-yl]-N-(4-chloro-2-methylphenyl)acetamide |
|---|---|
| PubChem CID | 114395086 |
| Molecular Formula | C14H20ClN3O2 |
| Molecular Weight | 297.79 g/mol |
| Exact Mass | 297.12 |
| IUPAC Name | 2-[2-(aminomethyl)morpholin-4-yl]-N-(4-chloro-2-methylphenyl)acetamide |
| SMILES | Cc1cc(Cl)ccc1NC(=O)CN1CCOC(CN)C1 |
| InChI | InChI=1S/C14H20ClN3O2/c1-10-6-11(15)2-3-13(10)17-14(19)9-18-4-5-20-12(7-16)8-18/h2-3,6,12H,4-5,7-9,16H2,1H3,(H,17,19) |
| InChIKey | ARCBPMNAQCKKAY-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 67.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.79 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |