C11H14INO4 — CID 11439531
methyl (1R,5S,9S)-9-iodo-4,4-dimethyl-3-oxo-2-oxa-8-azabicyclo[3.3.1]non-6-ene-8-carboxylate (PubChem CID 11439531) has the molecular formula C11H14INO4 and a molecular weight of 351.14 g/mol. Its IUPAC name is methyl (1R,5S,9S)-9-iodo-4,4-dimethyl-3-oxo-2-oxa-8-azabicyclo[3.3.1]non-6-ene-8-carboxylate.
| Compound Name | methyl (1R,5S,9S)-9-iodo-4,4-dimethyl-3-oxo-2-oxa-8-azabicyclo[3.3.1]non-6-ene-8-carboxylate |
|---|---|
| PubChem CID | 11439531 |
| Molecular Formula | C11H14INO4 |
| Molecular Weight | 351.14 g/mol |
| Exact Mass | 351.00 |
| IUPAC Name | methyl (1R,5S,9S)-9-iodo-4,4-dimethyl-3-oxo-2-oxa-8-azabicyclo[3.3.1]non-6-ene-8-carboxylate |
| SMILES | COC(=O)N1C=C[C@@H]2[C@H](I)[C@H]1OC(=O)C2(C)C |
| InChI | InChI=1S/C11H14INO4/c1-11(2)6-4-5-13(10(15)16-3)8(7(6)12)17-9(11)14/h4-8H,1-3H3/t6-,7+,8-/m1/s1 |
| InChIKey | MCEDDTMUFFPGFS-GJMOJQLCSA-N |
| XLogP | 1.91 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.14 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|