C8H18N2O — CID 114396652
1-cyclopropyl-N'-methoxy-N'-methylpropane-1,3-diamine (PubChem CID 114396652) has the molecular formula C8H18N2O and a molecular weight of 158.24 g/mol. Its IUPAC name is 1-cyclopropyl-N'-methoxy-N'-methylpropane-1,3-diamine.
| Compound Name | 1-cyclopropyl-N'-methoxy-N'-methylpropane-1,3-diamine |
|---|---|
| PubChem CID | 114396652 |
| Molecular Formula | C8H18N2O |
| Molecular Weight | 158.24 g/mol |
| Exact Mass | 158.14 |
| IUPAC Name | 1-cyclopropyl-N'-methoxy-N'-methylpropane-1,3-diamine |
| SMILES | CON(C)CCC(N)C1CC1 |
| InChI | InChI=1S/C8H18N2O/c1-10(11-2)6-5-8(9)7-3-4-7/h7-8H,3-6,9H2,1-2H3 |
| InChIKey | OASWUAKOUUIHFL-UHFFFAOYSA-N |
| XLogP | 0.61 |
| TPSA | 38.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 158.24 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|