About 2-(3-azidopropyl)-5-(2,2-dimethylmorpholin-4-yl)pyridazin-3-one
2-(3-azidopropyl)-5-(2,2-dimethylmorpholin-4-yl)pyridazin-3-one (PubChem CID 114396856) has the molecular formula C13H20N6O2
and a molecular weight of 292.34 g/mol. Its IUPAC name is 2-(3-azidopropyl)-5-(2,2-dimethylmorpholin-4-yl)pyridazin-3-one.
Molecular Properties
| Compound Name | 2-(3-azidopropyl)-5-(2,2-dimethylmorpholin-4-yl)pyridazin-3-one |
| PubChem CID | 114396856 |
| Molecular Formula | C13H20N6O2 |
| Molecular Weight | 292.34 g/mol |
| Exact Mass | 292.16 |
| IUPAC Name | 2-(3-azidopropyl)-5-(2,2-dimethylmorpholin-4-yl)pyridazin-3-one |
| SMILES | CC1(C)CN(c2cnn(CCCN=[N+]=[N-])c(=O)c2)CCO1 |
| InChI | InChI=1S/C13H20N6O2/c1-13(2)10-18(6-7-21-13)11-8-12(20)19(16-9-11)5-3-4-15-17-14/h8-9H,3-7,10H2,1-2H3 |
| InChIKey | OUNPNGUTXILBNB-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 96.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 292.34 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|
Analyze 2-(3-azidopropyl)-5-(2,2-dimethylmorpholin-4-yl)pyridazin-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(3-azidopropyl)-5-(2,2-dimethylmorpholin-4-yl)pyridazin-3-one?
The IUPAC name of 2-(3-azidopropyl)-5-(2,2-dimethylmorpholin-4-yl)pyridazin-3-one (CID 114396856) is 2-(3-azidopropyl)-5-(2,2-dimethylmorpholin-4-yl)pyridazin-3-one.
What is the SMILES notation for 2-(3-azidopropyl)-5-(2,2-dimethylmorpholin-4-yl)pyridazin-3-one?
The canonical SMILES for 2-(3-azidopropyl)-5-(2,2-dimethylmorpholin-4-yl)pyridazin-3-one is CC1(C)CN(c2cnn(CCCN=[N+]=[N-])c(=O)c2)CCO1.
What is the InChIKey of 2-(3-azidopropyl)-5-(2,2-dimethylmorpholin-4-yl)pyridazin-3-one?
The InChIKey is OUNPNGUTXILBNB-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H20N6O2/c1-13(2)10-18(6-7-21-13)11-8-12(20)19(16-9-11)5-3-4-15-17-14/h8-9H,3-7,10H2,1-2H3.
What are the key properties of 2-(3-azidopropyl)-5-(2,2-dimethylmorpholin-4-yl)pyridazin-3-one?
2-(3-azidopropyl)-5-(2,2-dimethylmorpholin-4-yl)pyridazin-3-one has a molecular weight of 292.34 g/mol, XLogP of 1.56, 5 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3-azidopropyl)-5-(2,2-dimethylmorpholin-4-yl)pyridazin-3-one is sourced from PubChem (CID 114396856), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).