C10H15F3N4O — CID 114397459
5-(dimethylamino)-2-[2-(2,2,2-trifluoroethylamino)ethyl]pyridazin-3-one (PubChem CID 114397459) has the molecular formula C10H15F3N4O and a molecular weight of 264.25 g/mol. Its IUPAC name is 5-(dimethylamino)-2-[2-(2,2,2-trifluoroethylamino)ethyl]pyridazin-3-one.
| Compound Name | 5-(dimethylamino)-2-[2-(2,2,2-trifluoroethylamino)ethyl]pyridazin-3-one |
|---|---|
| PubChem CID | 114397459 |
| Molecular Formula | C10H15F3N4O |
| Molecular Weight | 264.25 g/mol |
| Exact Mass | 264.12 |
| IUPAC Name | 5-(dimethylamino)-2-[2-(2,2,2-trifluoroethylamino)ethyl]pyridazin-3-one |
| SMILES | CN(C)c1cnn(CCNCC(F)(F)F)c(=O)c1 |
| InChI | InChI=1S/C10H15F3N4O/c1-16(2)8-5-9(18)17(15-6-8)4-3-14-7-10(11,12)13/h5-6,14H,3-4,7H2,1-2H3 |
| InChIKey | WRFFIOUCBGZMMI-UHFFFAOYSA-N |
| XLogP | 0.46 |
| TPSA | 50.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.25 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|