C12H19F3N4O — CID 114397731
5-[methyl(propyl)amino]-2-[2-(2,2,2-trifluoroethylamino)ethyl]pyridazin-3-one (PubChem CID 114397731) has the molecular formula C12H19F3N4O and a molecular weight of 292.31 g/mol. Its IUPAC name is 5-[methyl(propyl)amino]-2-[2-(2,2,2-trifluoroethylamino)ethyl]pyridazin-3-one.
| Compound Name | 5-[methyl(propyl)amino]-2-[2-(2,2,2-trifluoroethylamino)ethyl]pyridazin-3-one |
|---|---|
| PubChem CID | 114397731 |
| Molecular Formula | C12H19F3N4O |
| Molecular Weight | 292.31 g/mol |
| Exact Mass | 292.15 |
| IUPAC Name | 5-[methyl(propyl)amino]-2-[2-(2,2,2-trifluoroethylamino)ethyl]pyridazin-3-one |
| SMILES | CCCN(C)c1cnn(CCNCC(F)(F)F)c(=O)c1 |
| InChI | InChI=1S/C12H19F3N4O/c1-3-5-18(2)10-7-11(20)19(17-8-10)6-4-16-9-12(13,14)15/h7-8,16H,3-6,9H2,1-2H3 |
| InChIKey | PJUDPQPKJVCQRW-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 50.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.31 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|