About 4-[4-(dimethylamino)-6-oxopyridazin-1-yl]-2,2-dimethylbutanoic acid
4-[4-(dimethylamino)-6-oxopyridazin-1-yl]-2,2-dimethylbutanoic acid (PubChem CID 114397998) has the molecular formula C12H19N3O3
and a molecular weight of 253.30 g/mol. Its IUPAC name is 4-[4-(dimethylamino)-6-oxopyridazin-1-yl]-2,2-dimethylbutanoic acid.
Molecular Properties
| Compound Name | 4-[4-(dimethylamino)-6-oxopyridazin-1-yl]-2,2-dimethylbutanoic acid |
| PubChem CID | 114397998 |
| Molecular Formula | C12H19N3O3 |
| Molecular Weight | 253.30 g/mol |
| Exact Mass | 253.14 |
| IUPAC Name | 4-[4-(dimethylamino)-6-oxopyridazin-1-yl]-2,2-dimethylbutanoic acid |
| SMILES | CN(C)c1cnn(CCC(C)(C)C(=O)O)c(=O)c1 |
| InChI | InChI=1S/C12H19N3O3/c1-12(2,11(17)18)5-6-15-10(16)7-9(8-13-15)14(3)4/h7-8H,5-6H2,1-4H3,(H,17,18) |
| InChIKey | SYGZYJOATAIGGW-UHFFFAOYSA-N |
| XLogP | 0.81 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 253.30 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 4-[4-(dimethylamino)-6-oxopyridazin-1-yl]-2,2-dimethylbutanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[4-(dimethylamino)-6-oxopyridazin-1-yl]-2,2-dimethylbutanoic acid?
The IUPAC name of 4-[4-(dimethylamino)-6-oxopyridazin-1-yl]-2,2-dimethylbutanoic acid (CID 114397998) is 4-[4-(dimethylamino)-6-oxopyridazin-1-yl]-2,2-dimethylbutanoic acid.
What is the SMILES notation for 4-[4-(dimethylamino)-6-oxopyridazin-1-yl]-2,2-dimethylbutanoic acid?
The canonical SMILES for 4-[4-(dimethylamino)-6-oxopyridazin-1-yl]-2,2-dimethylbutanoic acid is CN(C)c1cnn(CCC(C)(C)C(=O)O)c(=O)c1.
What is the InChIKey of 4-[4-(dimethylamino)-6-oxopyridazin-1-yl]-2,2-dimethylbutanoic acid?
The InChIKey is SYGZYJOATAIGGW-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H19N3O3/c1-12(2,11(17)18)5-6-15-10(16)7-9(8-13-15)14(3)4/h7-8H,5-6H2,1-4H3,(H,17,18).
What are the key properties of 4-[4-(dimethylamino)-6-oxopyridazin-1-yl]-2,2-dimethylbutanoic acid?
4-[4-(dimethylamino)-6-oxopyridazin-1-yl]-2,2-dimethylbutanoic acid has a molecular weight of 253.30 g/mol, XLogP of 0.81, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[4-(dimethylamino)-6-oxopyridazin-1-yl]-2,2-dimethylbutanoic acid is sourced from PubChem (CID 114397998), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).