C11H19N5O2 — CID 114398617
2-[4-[methyl(propyl)amino]-6-oxopyridazin-1-yl]propanehydrazide (PubChem CID 114398617) has the molecular formula C11H19N5O2 and a molecular weight of 253.31 g/mol. Its IUPAC name is 2-[4-[methyl(propyl)amino]-6-oxopyridazin-1-yl]propanehydrazide.
| Compound Name | 2-[4-[methyl(propyl)amino]-6-oxopyridazin-1-yl]propanehydrazide |
|---|---|
| PubChem CID | 114398617 |
| Molecular Formula | C11H19N5O2 |
| Molecular Weight | 253.31 g/mol |
| Exact Mass | 253.15 |
| IUPAC Name | 2-[4-[methyl(propyl)amino]-6-oxopyridazin-1-yl]propanehydrazide |
| SMILES | CCCN(C)c1cnn(C(C)C(=O)NN)c(=O)c1 |
| InChI | InChI=1S/C11H19N5O2/c1-4-5-15(3)9-6-10(17)16(13-7-9)8(2)11(18)14-12/h6-8H,4-5,12H2,1-3H3,(H,14,18) |
| InChIKey | LAUWDEKVOOCZHB-UHFFFAOYSA-N |
| XLogP | -0.36 |
| TPSA | 93.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.31 |
| LogP ≤ 5 | -0.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|