C11H16BF3N3O- — CID 114398769
trifluoro-[[4-(4-methylpiperidin-1-yl)-6-oxopyridazin-1-yl]methyl]boranuide (PubChem CID 114398769) has the molecular formula C11H16BF3N3O- and a molecular weight of 274.07 g/mol. Its IUPAC name is trifluoro-[[4-(4-methylpiperidin-1-yl)-6-oxopyridazin-1-yl]methyl]boranuide.
| Compound Name | trifluoro-[[4-(4-methylpiperidin-1-yl)-6-oxopyridazin-1-yl]methyl]boranuide |
|---|---|
| PubChem CID | 114398769 |
| Molecular Formula | C11H16BF3N3O- |
| Molecular Weight | 274.07 g/mol |
| Exact Mass | 274.13 |
| IUPAC Name | trifluoro-[[4-(4-methylpiperidin-1-yl)-6-oxopyridazin-1-yl]methyl]boranuide |
| SMILES | CC1CCN(c2cnn(C[B-](F)(F)F)c(=O)c2)CC1 |
| InChI | InChI=1S/C11H16BF3N3O/c1-9-2-4-17(5-3-9)10-6-11(19)18(16-7-10)8-12(13,14)15/h6-7,9H,2-5,8H2,1H3/q-1 |
| InChIKey | OZQXUFKOEBOUFO-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 38.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.07 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|