C16H22N2OS2 — CID 114399605
N-[(4-ethylmorpholin-2-yl)methyl]-1,1-dithiophen-2-ylmethanamine (PubChem CID 114399605) has the molecular formula C16H22N2OS2 and a molecular weight of 322.50 g/mol. Its IUPAC name is N-[(4-ethylmorpholin-2-yl)methyl]-1,1-dithiophen-2-ylmethanamine.
| Compound Name | N-[(4-ethylmorpholin-2-yl)methyl]-1,1-dithiophen-2-ylmethanamine |
|---|---|
| PubChem CID | 114399605 |
| Molecular Formula | C16H22N2OS2 |
| Molecular Weight | 322.50 g/mol |
| Exact Mass | 322.12 |
| IUPAC Name | N-[(4-ethylmorpholin-2-yl)methyl]-1,1-dithiophen-2-ylmethanamine |
| SMILES | CCN1CCOC(CNC(c2cccs2)c2cccs2)C1 |
| InChI | InChI=1S/C16H22N2OS2/c1-2-18-7-8-19-13(12-18)11-17-16(14-5-3-9-20-14)15-6-4-10-21-15/h3-6,9-10,13,16-17H,2,7-8,11-12H2,1H3 |
| InChIKey | KJHBKEYLNMFPCA-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.50 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |