About 3-(4,5-dihydro-1H-imidazol-2-ylamino)butan-1-ol
3-(4,5-dihydro-1H-imidazol-2-ylamino)butan-1-ol (PubChem CID 114400383) has the molecular formula C7H15N3O
and a molecular weight of 157.22 g/mol. Its IUPAC name is 3-(4,5-dihydro-1H-imidazol-2-ylamino)butan-1-ol.
Molecular Properties
| Compound Name | 3-(4,5-dihydro-1H-imidazol-2-ylamino)butan-1-ol |
| PubChem CID | 114400383 |
| Molecular Formula | C7H15N3O |
| Molecular Weight | 157.22 g/mol |
| Exact Mass | 157.12 |
| IUPAC Name | 3-(4,5-dihydro-1H-imidazol-2-ylamino)butan-1-ol |
| SMILES | CC(CCO)NC1=NCCN1 |
| InChI | InChI=1S/C7H15N3O/c1-6(2-5-11)10-7-8-3-4-9-7/h6,11H,2-5H2,1H3,(H2,8,9,10) |
| InChIKey | FHQKTUFETNXYJR-UHFFFAOYSA-N |
| XLogP | -0.69 |
| TPSA | 56.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 157.22 |
| LogP ≤ 5 | -0.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-(4,5-dihydro-1H-imidazol-2-ylamino)butan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(4,5-dihydro-1H-imidazol-2-ylamino)butan-1-ol?
The IUPAC name of 3-(4,5-dihydro-1H-imidazol-2-ylamino)butan-1-ol (CID 114400383) is 3-(4,5-dihydro-1H-imidazol-2-ylamino)butan-1-ol.
What is the SMILES notation for 3-(4,5-dihydro-1H-imidazol-2-ylamino)butan-1-ol?
The canonical SMILES for 3-(4,5-dihydro-1H-imidazol-2-ylamino)butan-1-ol is CC(CCO)NC1=NCCN1.
What is the InChIKey of 3-(4,5-dihydro-1H-imidazol-2-ylamino)butan-1-ol?
The InChIKey is FHQKTUFETNXYJR-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H15N3O/c1-6(2-5-11)10-7-8-3-4-9-7/h6,11H,2-5H2,1H3,(H2,8,9,10).
What are the key properties of 3-(4,5-dihydro-1H-imidazol-2-ylamino)butan-1-ol?
3-(4,5-dihydro-1H-imidazol-2-ylamino)butan-1-ol has a molecular weight of 157.22 g/mol, XLogP of -0.69, 3 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(4,5-dihydro-1H-imidazol-2-ylamino)butan-1-ol is sourced from PubChem (CID 114400383), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).