About (Z)-N,N-diethyl-2-(2-hydroxy-3-trimethylsilylphenyl)-3-phenylprop-2-enamide
(Z)-N,N-diethyl-2-(2-hydroxy-3-trimethylsilylphenyl)-3-phenylprop-2-enamide (PubChem CID 11440040) has the molecular formula C22H29NO2Si
and a molecular weight of 367.57 g/mol. Its IUPAC name is (Z)-N,N-diethyl-2-(2-hydroxy-3-trimethylsilylphenyl)-3-phenylprop-2-enamide.
Molecular Properties
| Compound Name | (Z)-N,N-diethyl-2-(2-hydroxy-3-trimethylsilylphenyl)-3-phenylprop-2-enamide |
| PubChem CID | 11440040 |
| Molecular Formula | C22H29NO2Si |
| Molecular Weight | 367.57 g/mol |
| Exact Mass | 367.20 |
| IUPAC Name | (Z)-N,N-diethyl-2-(2-hydroxy-3-trimethylsilylphenyl)-3-phenylprop-2-enamide |
| SMILES | CCN(CC)C(=O)/C(=C\c1ccccc1)c1cccc([Si](C)(C)C)c1O |
| InChI | InChI=1S/C22H29NO2Si/c1-6-23(7-2)22(25)19(16-17-12-9-8-10-13-17)18-14-11-15-20(21(18)24)26(3,4)5/h8-16,24H,6-7H2,1-5H3/b19-16- |
| InChIKey | MVAQWRYOXKFYQB-MNDPQUGUSA-N |
| XLogP | 4.35 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 367.57 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|
Analyze (Z)-N,N-diethyl-2-(2-hydroxy-3-trimethylsilylphenyl)-3-phenylprop-2-enamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z)-N,N-diethyl-2-(2-hydroxy-3-trimethylsilylphenyl)-3-phenylprop-2-enamide?
The IUPAC name of (Z)-N,N-diethyl-2-(2-hydroxy-3-trimethylsilylphenyl)-3-phenylprop-2-enamide (CID 11440040) is (Z)-N,N-diethyl-2-(2-hydroxy-3-trimethylsilylphenyl)-3-phenylprop-2-enamide.
What is the SMILES notation for (Z)-N,N-diethyl-2-(2-hydroxy-3-trimethylsilylphenyl)-3-phenylprop-2-enamide?
The canonical SMILES for (Z)-N,N-diethyl-2-(2-hydroxy-3-trimethylsilylphenyl)-3-phenylprop-2-enamide is CCN(CC)C(=O)/C(=C\c1ccccc1)c1cccc([Si](C)(C)C)c1O.
What is the InChIKey of (Z)-N,N-diethyl-2-(2-hydroxy-3-trimethylsilylphenyl)-3-phenylprop-2-enamide?
The InChIKey is MVAQWRYOXKFYQB-MNDPQUGUSA-N. The full InChI is InChI=1S/C22H29NO2Si/c1-6-23(7-2)22(25)19(16-17-12-9-8-10-13-17)18-14-11-15-20(21(18)24)26(3,4)5/h8-16,24H,6-7H2,1-5H3/b19-16-.
What are the key properties of (Z)-N,N-diethyl-2-(2-hydroxy-3-trimethylsilylphenyl)-3-phenylprop-2-enamide?
(Z)-N,N-diethyl-2-(2-hydroxy-3-trimethylsilylphenyl)-3-phenylprop-2-enamide has a molecular weight of 367.57 g/mol, XLogP of 4.35, 6 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-N,N-diethyl-2-(2-hydroxy-3-trimethylsilylphenyl)-3-phenylprop-2-enamide is sourced from PubChem (CID 11440040), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).