About 1-[1-(4,5-dihydro-1H-imidazol-2-yl)piperidin-2-yl]ethanamine
1-[1-(4,5-dihydro-1H-imidazol-2-yl)piperidin-2-yl]ethanamine (PubChem CID 114400507) has the molecular formula C10H20N4
and a molecular weight of 196.30 g/mol. Its IUPAC name is 1-[1-(4,5-dihydro-1H-imidazol-2-yl)piperidin-2-yl]ethanamine.
Molecular Properties
| Compound Name | 1-[1-(4,5-dihydro-1H-imidazol-2-yl)piperidin-2-yl]ethanamine |
| PubChem CID | 114400507 |
| Molecular Formula | C10H20N4 |
| Molecular Weight | 196.30 g/mol |
| Exact Mass | 196.17 |
| IUPAC Name | 1-[1-(4,5-dihydro-1H-imidazol-2-yl)piperidin-2-yl]ethanamine |
| SMILES | CC(N)C1CCCCN1C1=NCCN1 |
| InChI | InChI=1S/C10H20N4/c1-8(11)9-4-2-3-7-14(9)10-12-5-6-13-10/h8-9H,2-7,11H2,1H3,(H,12,13) |
| InChIKey | JFWDODCPCYWWKF-UHFFFAOYSA-N |
| XLogP | 0.15 |
| TPSA | 53.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 196.30 |
| LogP ≤ 5 | 0.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-[1-(4,5-dihydro-1H-imidazol-2-yl)piperidin-2-yl]ethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[1-(4,5-dihydro-1H-imidazol-2-yl)piperidin-2-yl]ethanamine?
The IUPAC name of 1-[1-(4,5-dihydro-1H-imidazol-2-yl)piperidin-2-yl]ethanamine (CID 114400507) is 1-[1-(4,5-dihydro-1H-imidazol-2-yl)piperidin-2-yl]ethanamine.
What is the SMILES notation for 1-[1-(4,5-dihydro-1H-imidazol-2-yl)piperidin-2-yl]ethanamine?
The canonical SMILES for 1-[1-(4,5-dihydro-1H-imidazol-2-yl)piperidin-2-yl]ethanamine is CC(N)C1CCCCN1C1=NCCN1.
What is the InChIKey of 1-[1-(4,5-dihydro-1H-imidazol-2-yl)piperidin-2-yl]ethanamine?
The InChIKey is JFWDODCPCYWWKF-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H20N4/c1-8(11)9-4-2-3-7-14(9)10-12-5-6-13-10/h8-9H,2-7,11H2,1H3,(H,12,13).
What are the key properties of 1-[1-(4,5-dihydro-1H-imidazol-2-yl)piperidin-2-yl]ethanamine?
1-[1-(4,5-dihydro-1H-imidazol-2-yl)piperidin-2-yl]ethanamine has a molecular weight of 196.30 g/mol, XLogP of 0.15, 1 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[1-(4,5-dihydro-1H-imidazol-2-yl)piperidin-2-yl]ethanamine is sourced from PubChem (CID 114400507), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).