C14H23N3O3S — CID 114400653
4-[(4-ethylmorpholin-2-yl)methylamino]-N-methylbenzenesulfonamide (PubChem CID 114400653) has the molecular formula C14H23N3O3S and a molecular weight of 313.42 g/mol. Its IUPAC name is 4-[(4-ethylmorpholin-2-yl)methylamino]-N-methylbenzenesulfonamide.
| Compound Name | 4-[(4-ethylmorpholin-2-yl)methylamino]-N-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 114400653 |
| Molecular Formula | C14H23N3O3S |
| Molecular Weight | 313.42 g/mol |
| Exact Mass | 313.15 |
| IUPAC Name | 4-[(4-ethylmorpholin-2-yl)methylamino]-N-methylbenzenesulfonamide |
| SMILES | CCN1CCOC(CNc2ccc(S(=O)(=O)NC)cc2)C1 |
| InChI | InChI=1S/C14H23N3O3S/c1-3-17-8-9-20-13(11-17)10-16-12-4-6-14(7-5-12)21(18,19)15-2/h4-7,13,15-16H,3,8-11H2,1-2H3 |
| InChIKey | RNSDXMSTYYUWBF-UHFFFAOYSA-N |
| XLogP | 0.73 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.42 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |