C18H28N2O2S2 — CID 11440066
1-[[(1R,9aS)-spiro[1,2,3,4,6,7,8,9a-octahydroquinolizine-9,2'-1,3-dithiane]-1-yl]methyl]piperidine-2,6-dione (PubChem CID 11440066) has the molecular formula C18H28N2O2S2 and a molecular weight of 368.57 g/mol. Its IUPAC name is 1-[[(1R,9aS)-spiro[1,2,3,4,6,7,8,9a-octahydroquinolizine-9,2'-1,3-dithiane]-1-yl]methyl]piperidine-2,6-dione.
| Compound Name | 1-[[(1R,9aS)-spiro[1,2,3,4,6,7,8,9a-octahydroquinolizine-9,2'-1,3-dithiane]-1-yl]methyl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 11440066 |
| Molecular Formula | C18H28N2O2S2 |
| Molecular Weight | 368.57 g/mol |
| Exact Mass | 368.16 |
| IUPAC Name | 1-[[(1R,9aS)-spiro[1,2,3,4,6,7,8,9a-octahydroquinolizine-9,2'-1,3-dithiane]-1-yl]methyl]piperidine-2,6-dione |
| SMILES | O=C1CCCC(=O)N1C[C@H]1CCCN2CCCC3(SCCCS3)[C@H]12 |
| InChI | InChI=1S/C18H28N2O2S2/c21-15-6-1-7-16(22)20(15)13-14-5-2-9-19-10-3-8-18(17(14)19)23-11-4-12-24-18/h14,17H,1-13H2/t14-,17+/m1/s1 |
| InChIKey | XSZFYEYZQVOLOS-PBHICJAKSA-N |
| XLogP | 2.97 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.57 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|