C21H40O3Si — CID 11440071
(2E,5E)-2-[2-[tert-butyl(dimethyl)silyl]oxyethylidene]-6,10-dimethylundeca-5,9-diene-1,3-diol (PubChem CID 11440071) has the molecular formula C21H40O3Si and a molecular weight of 368.63 g/mol. Its IUPAC name is (2E,5E)-2-[2-[tert-butyl(dimethyl)silyl]oxyethylidene]-6,10-dimethylundeca-5,9-diene-1,3-diol.
| Compound Name | (2E,5E)-2-[2-[tert-butyl(dimethyl)silyl]oxyethylidene]-6,10-dimethylundeca-5,9-diene-1,3-diol |
|---|---|
| PubChem CID | 11440071 |
| Molecular Formula | C21H40O3Si |
| Molecular Weight | 368.63 g/mol |
| Exact Mass | 368.27 |
| IUPAC Name | (2E,5E)-2-[2-[tert-butyl(dimethyl)silyl]oxyethylidene]-6,10-dimethylundeca-5,9-diene-1,3-diol |
| SMILES | CC(C)=CCC/C(C)=C/CC(O)/C(=C/CO[Si](C)(C)C(C)(C)C)CO |
| InChI | InChI=1S/C21H40O3Si/c1-17(2)10-9-11-18(3)12-13-20(23)19(16-22)14-15-24-25(7,8)21(4,5)6/h10,12,14,20,22-23H,9,11,13,15-16H2,1-8H3/b18-12+,19-14+ |
| InChIKey | LMSSOUOXRFDRGE-IJNKXORISA-N |
| XLogP | 5.37 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.63 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|