About N-(4,5-dihydro-1H-imidazol-2-yl)-N'-propan-2-ylethane-1,2-diamine
N-(4,5-dihydro-1H-imidazol-2-yl)-N'-propan-2-ylethane-1,2-diamine (PubChem CID 114401726) has the molecular formula C8H18N4
and a molecular weight of 170.26 g/mol. Its IUPAC name is N-(4,5-dihydro-1H-imidazol-2-yl)-N'-propan-2-ylethane-1,2-diamine.
Molecular Properties
| Compound Name | N-(4,5-dihydro-1H-imidazol-2-yl)-N'-propan-2-ylethane-1,2-diamine |
| PubChem CID | 114401726 |
| Molecular Formula | C8H18N4 |
| Molecular Weight | 170.26 g/mol |
| Exact Mass | 170.15 |
| IUPAC Name | N-(4,5-dihydro-1H-imidazol-2-yl)-N'-propan-2-ylethane-1,2-diamine |
| SMILES | CC(C)NCCNC1=NCCN1 |
| InChI | InChI=1S/C8H18N4/c1-7(2)9-3-4-10-8-11-5-6-12-8/h7,9H,3-6H2,1-2H3,(H2,10,11,12) |
| InChIKey | FMDNEGRWHZLONP-UHFFFAOYSA-N |
| XLogP | -0.47 |
| TPSA | 48.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 170.26 |
| LogP ≤ 5 | -0.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N-(4,5-dihydro-1H-imidazol-2-yl)-N'-propan-2-ylethane-1,2-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(4,5-dihydro-1H-imidazol-2-yl)-N'-propan-2-ylethane-1,2-diamine?
The IUPAC name of N-(4,5-dihydro-1H-imidazol-2-yl)-N'-propan-2-ylethane-1,2-diamine (CID 114401726) is N-(4,5-dihydro-1H-imidazol-2-yl)-N'-propan-2-ylethane-1,2-diamine.
What is the SMILES notation for N-(4,5-dihydro-1H-imidazol-2-yl)-N'-propan-2-ylethane-1,2-diamine?
The canonical SMILES for N-(4,5-dihydro-1H-imidazol-2-yl)-N'-propan-2-ylethane-1,2-diamine is CC(C)NCCNC1=NCCN1.
What is the InChIKey of N-(4,5-dihydro-1H-imidazol-2-yl)-N'-propan-2-ylethane-1,2-diamine?
The InChIKey is FMDNEGRWHZLONP-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H18N4/c1-7(2)9-3-4-10-8-11-5-6-12-8/h7,9H,3-6H2,1-2H3,(H2,10,11,12).
What are the key properties of N-(4,5-dihydro-1H-imidazol-2-yl)-N'-propan-2-ylethane-1,2-diamine?
N-(4,5-dihydro-1H-imidazol-2-yl)-N'-propan-2-ylethane-1,2-diamine has a molecular weight of 170.26 g/mol, XLogP of -0.47, 4 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-(4,5-dihydro-1H-imidazol-2-yl)-N'-propan-2-ylethane-1,2-diamine is sourced from PubChem (CID 114401726), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).