About 1-N-(4,5-dihydro-1H-imidazol-2-yl)propane-1,2-diamine
1-N-(4,5-dihydro-1H-imidazol-2-yl)propane-1,2-diamine (PubChem CID 114401743) has the molecular formula C6H14N4
and a molecular weight of 142.21 g/mol. Its IUPAC name is 1-N-(4,5-dihydro-1H-imidazol-2-yl)propane-1,2-diamine.
Molecular Properties
| Compound Name | 1-N-(4,5-dihydro-1H-imidazol-2-yl)propane-1,2-diamine |
| PubChem CID | 114401743 |
| Molecular Formula | C6H14N4 |
| Molecular Weight | 142.21 g/mol |
| Exact Mass | 142.12 |
| IUPAC Name | 1-N-(4,5-dihydro-1H-imidazol-2-yl)propane-1,2-diamine |
| SMILES | CC(N)CNC1=NCCN1 |
| InChI | InChI=1S/C6H14N4/c1-5(7)4-10-6-8-2-3-9-6/h5H,2-4,7H2,1H3,(H2,8,9,10) |
| InChIKey | FUZZVILYBVGVEU-UHFFFAOYSA-N |
| XLogP | -1.12 |
| TPSA | 62.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 142.21 |
| LogP ≤ 5 | -1.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-N-(4,5-dihydro-1H-imidazol-2-yl)propane-1,2-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-N-(4,5-dihydro-1H-imidazol-2-yl)propane-1,2-diamine?
The IUPAC name of 1-N-(4,5-dihydro-1H-imidazol-2-yl)propane-1,2-diamine (CID 114401743) is 1-N-(4,5-dihydro-1H-imidazol-2-yl)propane-1,2-diamine.
What is the SMILES notation for 1-N-(4,5-dihydro-1H-imidazol-2-yl)propane-1,2-diamine?
The canonical SMILES for 1-N-(4,5-dihydro-1H-imidazol-2-yl)propane-1,2-diamine is CC(N)CNC1=NCCN1.
What is the InChIKey of 1-N-(4,5-dihydro-1H-imidazol-2-yl)propane-1,2-diamine?
The InChIKey is FUZZVILYBVGVEU-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H14N4/c1-5(7)4-10-6-8-2-3-9-6/h5H,2-4,7H2,1H3,(H2,8,9,10).
What are the key properties of 1-N-(4,5-dihydro-1H-imidazol-2-yl)propane-1,2-diamine?
1-N-(4,5-dihydro-1H-imidazol-2-yl)propane-1,2-diamine has a molecular weight of 142.21 g/mol, XLogP of -1.12, 2 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-N-(4,5-dihydro-1H-imidazol-2-yl)propane-1,2-diamine is sourced from PubChem (CID 114401743), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).