C16H20O10 — CID 11440178
methyl (3S,4R,5R,6S)-3,4,5,6-tetraacetyloxycyclohexene-1-carboxylate (PubChem CID 11440178) has the molecular formula C16H20O10 and a molecular weight of 372.33 g/mol. Its IUPAC name is methyl (3S,4R,5R,6S)-3,4,5,6-tetraacetyloxycyclohexene-1-carboxylate.
| Compound Name | methyl (3S,4R,5R,6S)-3,4,5,6-tetraacetyloxycyclohexene-1-carboxylate |
|---|---|
| PubChem CID | 11440178 |
| Molecular Formula | C16H20O10 |
| Molecular Weight | 372.33 g/mol |
| Exact Mass | 372.11 |
| IUPAC Name | methyl (3S,4R,5R,6S)-3,4,5,6-tetraacetyloxycyclohexene-1-carboxylate |
| SMILES | COC(=O)C1=C[C@H](OC(C)=O)[C@@H](OC(C)=O)[C@H](OC(C)=O)[C@H]1OC(C)=O |
| InChI | InChI=1S/C16H20O10/c1-7(17)23-12-6-11(16(21)22-5)13(24-8(2)18)15(26-10(4)20)14(12)25-9(3)19/h6,12-15H,1-5H3/t12-,13-,14+,15+/m0/s1 |
| InChIKey | FMFTVFPCBWMIKB-BYNSBNAKSA-N |
| XLogP | -0.17 |
| TPSA | 131.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.33 |
| LogP ≤ 5 | -0.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|