C13H16N4O4 — CID 114401865
methyl 2-cyclopentyl-2-(2,6-dioxo-3,7-dihydropurin-8-yl)acetate (PubChem CID 114401865) has the molecular formula C13H16N4O4 and a molecular weight of 292.30 g/mol. Its IUPAC name is methyl 2-cyclopentyl-2-(2,6-dioxo-3,7-dihydropurin-8-yl)acetate.
| Compound Name | methyl 2-cyclopentyl-2-(2,6-dioxo-3,7-dihydropurin-8-yl)acetate |
|---|---|
| PubChem CID | 114401865 |
| Molecular Formula | C13H16N4O4 |
| Molecular Weight | 292.30 g/mol |
| Exact Mass | 292.12 |
| IUPAC Name | methyl 2-cyclopentyl-2-(2,6-dioxo-3,7-dihydropurin-8-yl)acetate |
| SMILES | COC(=O)C(c1nc2[nH]c(=O)[nH]c(=O)c2[nH]1)C1CCCC1 |
| InChI | InChI=1S/C13H16N4O4/c1-21-12(19)7(6-4-2-3-5-6)9-14-8-10(15-9)16-13(20)17-11(8)18/h6-7H,2-5H2,1H3,(H3,14,15,16,17,18,20) |
| InChIKey | QJKDOYQZQZSWLZ-UHFFFAOYSA-N |
| XLogP | 0.39 |
| TPSA | 120.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.30 |
| LogP ≤ 5 | 0.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |