C14H23N5O2 — CID 114402156
8-[3-(2-aminoethyl)-4,4-dimethylpentyl]-3,7-dihydropurine-2,6-dione (PubChem CID 114402156) has the molecular formula C14H23N5O2 and a molecular weight of 293.37 g/mol. Its IUPAC name is 8-[3-(2-aminoethyl)-4,4-dimethylpentyl]-3,7-dihydropurine-2,6-dione.
| Compound Name | 8-[3-(2-aminoethyl)-4,4-dimethylpentyl]-3,7-dihydropurine-2,6-dione |
|---|---|
| PubChem CID | 114402156 |
| Molecular Formula | C14H23N5O2 |
| Molecular Weight | 293.37 g/mol |
| Exact Mass | 293.19 |
| IUPAC Name | 8-[3-(2-aminoethyl)-4,4-dimethylpentyl]-3,7-dihydropurine-2,6-dione |
| SMILES | CC(C)(C)C(CCN)CCc1nc2[nH]c(=O)[nH]c(=O)c2[nH]1 |
| InChI | InChI=1S/C14H23N5O2/c1-14(2,3)8(6-7-15)4-5-9-16-10-11(17-9)18-13(21)19-12(10)20/h8H,4-7,15H2,1-3H3,(H3,16,17,18,19,20,21) |
| InChIKey | FRXWISBNUUGPNZ-UHFFFAOYSA-N |
| XLogP | 0.88 |
| TPSA | 120.42 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.37 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |