C10H6FN5O2 — CID 114402872
8-(5-fluoro-2-pyridinyl)-3,7-dihydropurine-2,6-dione (PubChem CID 114402872) has the molecular formula C10H6FN5O2 and a molecular weight of 247.19 g/mol. Its IUPAC name is 8-(5-fluoro-2-pyridinyl)-3,7-dihydropurine-2,6-dione.
| Compound Name | 8-(5-fluoro-2-pyridinyl)-3,7-dihydropurine-2,6-dione |
|---|---|
| PubChem CID | 114402872 |
| Molecular Formula | C10H6FN5O2 |
| Molecular Weight | 247.19 g/mol |
| Exact Mass | 247.05 |
| IUPAC Name | 8-(5-fluoro-2-pyridinyl)-3,7-dihydropurine-2,6-dione |
| SMILES | O=c1[nH]c(=O)c2[nH]c(-c3ccc(F)cn3)nc2[nH]1 |
| InChI | InChI=1S/C10H6FN5O2/c11-4-1-2-5(12-3-4)7-13-6-8(14-7)15-10(18)16-9(6)17/h1-3H,(H3,13,14,15,16,17,18) |
| InChIKey | ZGNBDVJVZPHTKX-UHFFFAOYSA-N |
| XLogP | 0.14 |
| TPSA | 107.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.19 |
| LogP ≤ 5 | 0.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |