C19H23NO5S — CID 11440315
[3-[(3R,3aR,4S,6aR,9bS)-3-methyl-3,3a,4,6a,7,8,9,9b-octahydro-2H-benzo[de]quinolin-1-ium-4-yl]-5-hydroxyphenyl] sulfate (PubChem CID 11440315) has the molecular formula C19H23NO5S and a molecular weight of 377.46 g/mol. Its IUPAC name is [3-[(3R,3aR,4S,6aR,9bS)-3-methyl-3,3a,4,6a,7,8,9,9b-octahydro-2H-benzo[de]quinolin-1-ium-4-yl]-5-hydroxyphenyl] sulfate.
| Compound Name | [3-[(3R,3aR,4S,6aR,9bS)-3-methyl-3,3a,4,6a,7,8,9,9b-octahydro-2H-benzo[de]quinolin-1-ium-4-yl]-5-hydroxyphenyl] sulfate |
|---|---|
| PubChem CID | 11440315 |
| Molecular Formula | C19H23NO5S |
| Molecular Weight | 377.46 g/mol |
| Exact Mass | 377.13 |
| IUPAC Name | [3-[(3R,3aR,4S,6aR,9bS)-3-methyl-3,3a,4,6a,7,8,9,9b-octahydro-2H-benzo[de]quinolin-1-ium-4-yl]-5-hydroxyphenyl] sulfate |
| SMILES | C[C@H]1C[NH+]=C2CCC[C@@H]3C=C[C@H](c4cc(O)cc(OS(=O)(=O)[O-])c4)[C@H]1[C@@H]23 |
| InChI | InChI=1S/C19H23NO5S/c1-11-10-20-17-4-2-3-12-5-6-16(18(11)19(12)17)13-7-14(21)9-15(8-13)25-26(22,23)24/h5-9,11-12,16,18-19,21H,2-4,10H2,1H3,(H,22,23,24)/t11-,12+,16+,18-,19+/m0/s1 |
| InChIKey | OYLCGJSDLVRIKW-FBLTZUPUSA-N |
| XLogP | 1.09 |
| TPSA | 100.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.46 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'sulphate', 'substructure': 'N/A'} |
|---|