C14H20ClN3O3S2 — CID 11440324
3-(5-chloro-1,3-thiazol-2-yl)-1-cyclohexyl-1-(1,1-dioxothiolan-3-yl)urea (PubChem CID 11440324) has the molecular formula C14H20ClN3O3S2 and a molecular weight of 377.92 g/mol. Its IUPAC name is 3-(5-chloro-1,3-thiazol-2-yl)-1-cyclohexyl-1-(1,1-dioxothiolan-3-yl)urea.
| Compound Name | 3-(5-chloro-1,3-thiazol-2-yl)-1-cyclohexyl-1-(1,1-dioxothiolan-3-yl)urea |
|---|---|
| PubChem CID | 11440324 |
| Molecular Formula | C14H20ClN3O3S2 |
| Molecular Weight | 377.92 g/mol |
| Exact Mass | 377.06 |
| IUPAC Name | 3-(5-chloro-1,3-thiazol-2-yl)-1-cyclohexyl-1-(1,1-dioxothiolan-3-yl)urea |
| SMILES | O=C(Nc1ncc(Cl)s1)N(C1CCCCC1)C1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C14H20ClN3O3S2/c15-12-8-16-13(22-12)17-14(19)18(10-4-2-1-3-5-10)11-6-7-23(20,21)9-11/h8,10-11H,1-7,9H2,(H,16,17,19) |
| InChIKey | FIPGNAJLHSFZPN-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 79.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.92 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |