C13H12N4O4 — CID 114403632
5-nitro-6-(1-pyridin-4-ylethylamino)pyridine-2-carboxylic acid (PubChem CID 114403632) has the molecular formula C13H12N4O4 and a molecular weight of 288.26 g/mol. Its IUPAC name is 5-nitro-6-(1-pyridin-4-ylethylamino)pyridine-2-carboxylic acid.
| Compound Name | 5-nitro-6-(1-pyridin-4-ylethylamino)pyridine-2-carboxylic acid |
|---|---|
| PubChem CID | 114403632 |
| Molecular Formula | C13H12N4O4 |
| Molecular Weight | 288.26 g/mol |
| Exact Mass | 288.09 |
| IUPAC Name | 5-nitro-6-(1-pyridin-4-ylethylamino)pyridine-2-carboxylic acid |
| SMILES | CC(Nc1nc(C(=O)O)ccc1[N+](=O)[O-])c1ccncc1 |
| InChI | InChI=1S/C13H12N4O4/c1-8(9-4-6-14-7-5-9)15-12-11(17(20)21)3-2-10(16-12)13(18)19/h2-8H,1H3,(H,15,16)(H,18,19) |
| InChIKey | VUCOJXOPJQDEGG-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 118.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.26 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|