C25H32O3 — CID 11440405
(1R,3R,3aS,4S,5R,7aS)-4,5-diethyl-1,3,7-trimethyl-2-oxo-5-[(E)-2-phenylethenyl]-1,3,3a,7a-tetrahydroindene-4-carboxylic acid (PubChem CID 11440405) has the molecular formula C25H32O3 and a molecular weight of 380.53 g/mol. Its IUPAC name is (1R,3R,3aS,4S,5R,7aS)-4,5-diethyl-1,3,7-trimethyl-2-oxo-5-[(E)-2-phenylethenyl]-1,3,3a,7a-tetrahydroindene-4-carboxylic acid.
| Compound Name | (1R,3R,3aS,4S,5R,7aS)-4,5-diethyl-1,3,7-trimethyl-2-oxo-5-[(E)-2-phenylethenyl]-1,3,3a,7a-tetrahydroindene-4-carboxylic acid |
|---|---|
| PubChem CID | 11440405 |
| Molecular Formula | C25H32O3 |
| Molecular Weight | 380.53 g/mol |
| Exact Mass | 380.24 |
| IUPAC Name | (1R,3R,3aS,4S,5R,7aS)-4,5-diethyl-1,3,7-trimethyl-2-oxo-5-[(E)-2-phenylethenyl]-1,3,3a,7a-tetrahydroindene-4-carboxylic acid |
| SMILES | CC[C@@]1(/C=C/c2ccccc2)C=C(C)[C@H]2[C@@H]([C@@H](C)C(=O)[C@@H]2C)[C@]1(CC)C(=O)O |
| InChI | InChI=1S/C25H32O3/c1-6-24(14-13-19-11-9-8-10-12-19)15-16(3)20-17(4)22(26)18(5)21(20)25(24,7-2)23(27)28/h8-15,17-18,20-21H,6-7H2,1-5H3,(H,27,28)/b14-13+/t17-,18-,20-,21-,24-,25-/m1/s1 |
| InChIKey | IUHRGTBLTYEFAP-NVXQNEKZSA-N |
| XLogP | 5.62 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.53 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|